C12H17Cl2NO2 — CID 171160601
2-[(1R,2S)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4,6-dichlorophenol (PubChem CID 171160601) has the molecular formula C12H17Cl2NO2 and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4,6-dichlorophenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 171160601 |
| Molecular Formula | C12H17Cl2NO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4,6-dichlorophenol |
| SMILES | CC(C)(C)[C@H](O)[C@H](N)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H17Cl2NO2/c1-12(2,3)11(17)9(15)7-4-6(13)5-8(14)10(7)16/h4-5,9,11,16-17H,15H2,1-3H3/t9-,11-/m1/s1 |
| InChIKey | QPYKKLRHJZTXGT-MWLCHTKSSA-N |
| XLogP | 3.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|