C16H14ClN3O5 — CID 108513231
N'-(4-chloro-2-methoxy-5-methylphenyl)-N-(4-nitrophenyl)oxamide (PubChem CID 108513231) has the molecular formula C16H14ClN3O5 and a molecular weight of 363.76 g/mol. Its IUPAC name is N'-(4-chloro-2-methoxy-5-methylphenyl)-N-(4-nitrophenyl)oxamide.
| Compound Name | N'-(4-chloro-2-methoxy-5-methylphenyl)-N-(4-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 108513231 |
| Molecular Formula | C16H14ClN3O5 |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | N'-(4-chloro-2-methoxy-5-methylphenyl)-N-(4-nitrophenyl)oxamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H14ClN3O5/c1-9-7-13(14(25-2)8-12(9)17)19-16(22)15(21)18-10-3-5-11(6-4-10)20(23)24/h3-8H,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | YBDXOYDHNSIGBM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|