C18H10ClNO5 — CID 18877481
(Z)-4-[(3-chloro-9,10-dioxoanthracen-2-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 18877481) has the molecular formula C18H10ClNO5 and a molecular weight of 355.73 g/mol. Its IUPAC name is (Z)-4-[(3-chloro-9,10-dioxoanthracen-2-yl)amino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[(3-chloro-9,10-dioxoanthracen-2-yl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18877481 |
| Molecular Formula | C18H10ClNO5 |
| Molecular Weight | 355.73 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | (Z)-4-[(3-chloro-9,10-dioxoanthracen-2-yl)amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1cc2c(cc1Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H10ClNO5/c19-13-7-11-12(8-14(13)20-15(21)5-6-16(22)23)18(25)10-4-2-1-3-9(10)17(11)24/h1-8H,(H,20,21)(H,22,23)/b6-5- |
| InChIKey | ADEAMXNGYQYVOI-WAYWQWQTSA-N |
| XLogP | 2.69 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.73 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|