C17H12Cl3NO — CID 4147233
5-phenyl-N-(2,4,5-trichlorophenyl)penta-2,4-dienamide (PubChem CID 4147233) has the molecular formula C17H12Cl3NO and a molecular weight of 352.65 g/mol. Its IUPAC name is 5-phenyl-N-(2,4,5-trichlorophenyl)penta-2,4-dienamide.
| Compound Name | 5-phenyl-N-(2,4,5-trichlorophenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 4147233 |
| Molecular Formula | C17H12Cl3NO |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 5-phenyl-N-(2,4,5-trichlorophenyl)penta-2,4-dienamide |
| SMILES | O=C(C=CC=Cc1ccccc1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl3NO/c18-13-10-15(20)16(11-14(13)19)21-17(22)9-5-4-8-12-6-2-1-3-7-12/h1-11H,(H,21,22) |
| InChIKey | SWIUGJICMGHIIX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|