C22H16Cl2N2O — CID 570382
N-[2,5-dichloro-4-(cinnamylideneamino)phenyl]benzamide (PubChem CID 570382) has the molecular formula C22H16Cl2N2O and a molecular weight of 395.29 g/mol. Its IUPAC name is N-[2,5-dichloro-4-(cinnamylideneamino)phenyl]benzamide.
| Compound Name | N-[2,5-dichloro-4-(cinnamylideneamino)phenyl]benzamide |
|---|---|
| PubChem CID | 570382 |
| Molecular Formula | C22H16Cl2N2O |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | N-[2,5-dichloro-4-(cinnamylideneamino)phenyl]benzamide |
| SMILES | O=C(Nc1cc(Cl)c(/N=C/C=Cc2ccccc2)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H16Cl2N2O/c23-18-15-21(26-22(27)17-11-5-2-6-12-17)19(24)14-20(18)25-13-7-10-16-8-3-1-4-9-16/h1-15H,(H,26,27)/b10-7?,25-13+ |
| InChIKey | JJZRJPCYOFZDAC-HZBLVRCWSA-N |
| XLogP | 6.66 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|