C20H16Cl2N2O3 — CID 40612796
N-[2,4-dichloro-6-[(2-ethylphenyl)carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 40612796) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is N-[2,4-dichloro-6-[(2-ethylphenyl)carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2,4-dichloro-6-[(2-ethylphenyl)carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 40612796 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | N-[2,4-dichloro-6-[(2-ethylphenyl)carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1cc(Cl)cc(Cl)c1NC(=O)c1ccco1 |
| InChI | InChI=1S/C20H16Cl2N2O3/c1-2-12-6-3-4-7-16(12)23-19(25)14-10-13(21)11-15(22)18(14)24-20(26)17-8-5-9-27-17/h3-11H,2H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | XXHRZYNQOHIBBK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |