C14H12Cl2N2O3 — CID 82810639
3,5-dichloro-4-[(1,5-dimethylpyrrole-2-carbonyl)amino]benzoic acid (PubChem CID 82810639) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is 3,5-dichloro-4-[(1,5-dimethylpyrrole-2-carbonyl)amino]benzoic acid.
| Compound Name | 3,5-dichloro-4-[(1,5-dimethylpyrrole-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 82810639 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3,5-dichloro-4-[(1,5-dimethylpyrrole-2-carbonyl)amino]benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2c(Cl)cc(C(=O)O)cc2Cl)n1C |
| InChI | InChI=1S/C14H12Cl2N2O3/c1-7-3-4-11(18(7)2)13(19)17-12-9(15)5-8(14(20)21)6-10(12)16/h3-6H,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | UAEWIIDTFMQXAH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |