C19H16O5 — CID 58431996
[4-(furan-2-yl)-2,6-dimethoxyphenyl] benzoate (PubChem CID 58431996) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is [4-(furan-2-yl)-2,6-dimethoxyphenyl] benzoate.
| Compound Name | [4-(furan-2-yl)-2,6-dimethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 58431996 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | [4-(furan-2-yl)-2,6-dimethoxyphenyl] benzoate |
| SMILES | COc1cc(-c2ccco2)cc(OC)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16O5/c1-21-16-11-14(15-9-6-10-23-15)12-17(22-2)18(16)24-19(20)13-7-4-3-5-8-13/h3-12H,1-2H3 |
| InChIKey | HLLJGBXQABOJTR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|