C20H20O5 — CID 138636350
[4-[(Z)-1-ethenoxyprop-1-enyl]-2,6-dimethoxyphenyl] benzoate (PubChem CID 138636350) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is [4-[(Z)-1-ethenoxyprop-1-enyl]-2,6-dimethoxyphenyl] benzoate.
| Compound Name | [4-[(Z)-1-ethenoxyprop-1-enyl]-2,6-dimethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 138636350 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [4-[(Z)-1-ethenoxyprop-1-enyl]-2,6-dimethoxyphenyl] benzoate |
| SMILES | C=CO/C(=C\C)c1cc(OC)c(OC(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C20H20O5/c1-5-16(24-6-2)15-12-17(22-3)19(18(13-15)23-4)25-20(21)14-10-8-7-9-11-14/h5-13H,2H2,1,3-4H3/b16-5- |
| InChIKey | BNKXQAARVJFVAK-BNCCVWRVSA-N |
| XLogP | 4.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|