C26H26O9 — CID 100998359
[4-[2-(2,6-dimethoxyphenoxy)-3-hydroxypropanoyl]-2,6-dimethoxyphenyl] benzoate (PubChem CID 100998359) has the molecular formula C26H26O9 and a molecular weight of 482.49 g/mol. Its IUPAC name is [4-[2-(2,6-dimethoxyphenoxy)-3-hydroxypropanoyl]-2,6-dimethoxyphenyl] benzoate.
| Compound Name | [4-[2-(2,6-dimethoxyphenoxy)-3-hydroxypropanoyl]-2,6-dimethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 100998359 |
| Molecular Formula | C26H26O9 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | [4-[2-(2,6-dimethoxyphenoxy)-3-hydroxypropanoyl]-2,6-dimethoxyphenyl] benzoate |
| SMILES | COc1cc(C(=O)C(CO)Oc2c(OC)cccc2OC)cc(OC)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26O9/c1-30-18-11-8-12-19(31-2)24(18)34-22(15-27)23(28)17-13-20(32-3)25(21(14-17)33-4)35-26(29)16-9-6-5-7-10-16/h5-14,22,27H,15H2,1-4H3 |
| InChIKey | YJJYGOTYXAJWRL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|