C8H7ClF2N2O2 — CID 118812031
4-amino-3-(difluoromethyl)-5-methoxypyridine-2-carbonyl chloride (PubChem CID 118812031) has the molecular formula C8H7ClF2N2O2 and a molecular weight of 236.60 g/mol. Its IUPAC name is 4-amino-3-(difluoromethyl)-5-methoxypyridine-2-carbonyl chloride.
| Compound Name | 4-amino-3-(difluoromethyl)-5-methoxypyridine-2-carbonyl chloride |
|---|---|
| PubChem CID | 118812031 |
| Molecular Formula | C8H7ClF2N2O2 |
| Molecular Weight | 236.60 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 4-amino-3-(difluoromethyl)-5-methoxypyridine-2-carbonyl chloride |
| SMILES | COc1cnc(C(=O)Cl)c(C(F)F)c1N |
| InChI | InChI=1S/C8H7ClF2N2O2/c1-15-3-2-13-6(7(9)14)4(5(3)12)8(10)11/h2,8H,1H3,(H2,12,13) |
| InChIKey | YAWMTJWBDFBRFT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.60 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|