C9H9F5N2O — CID 133084908
[2-(difluoromethyl)-5-methoxy-3-(trifluoromethyl)-4-pyridinyl]methanamine (PubChem CID 133084908) has the molecular formula C9H9F5N2O and a molecular weight of 256.17 g/mol. Its IUPAC name is [2-(difluoromethyl)-5-methoxy-3-(trifluoromethyl)-4-pyridinyl]methanamine.
| Compound Name | [2-(difluoromethyl)-5-methoxy-3-(trifluoromethyl)-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 133084908 |
| Molecular Formula | C9H9F5N2O |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | [2-(difluoromethyl)-5-methoxy-3-(trifluoromethyl)-4-pyridinyl]methanamine |
| SMILES | COc1cnc(C(F)F)c(C(F)(F)F)c1CN |
| InChI | InChI=1S/C9H9F5N2O/c1-17-5-3-16-7(8(10)11)6(4(5)2-15)9(12,13)14/h3,8H,2,15H2,1H3 |
| InChIKey | VGJDKUOLFSYALL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |