C9H8F6N2O — CID 118835408
[2-methyl-5-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]methanamine (PubChem CID 118835408) has the molecular formula C9H8F6N2O and a molecular weight of 274.16 g/mol. Its IUPAC name is [2-methyl-5-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]methanamine.
| Compound Name | [2-methyl-5-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 118835408 |
| Molecular Formula | C9H8F6N2O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [2-methyl-5-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]methanamine |
| SMILES | Cc1ncc(OC(F)(F)F)c(CN)c1C(F)(F)F |
| InChI | InChI=1S/C9H8F6N2O/c1-4-7(8(10,11)12)5(2-16)6(3-17-4)18-9(13,14)15/h3H,2,16H2,1H3 |
| InChIKey | ZRVMOQJXJMSSKX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |