C7H7ClF3N3O — CID 119001282
4-(aminomethyl)-3-chloro-5-(trifluoromethoxy)pyridin-2-amine (PubChem CID 119001282) has the molecular formula C7H7ClF3N3O and a molecular weight of 241.60 g/mol. Its IUPAC name is 4-(aminomethyl)-3-chloro-5-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | 4-(aminomethyl)-3-chloro-5-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 119001282 |
| Molecular Formula | C7H7ClF3N3O |
| Molecular Weight | 241.60 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 4-(aminomethyl)-3-chloro-5-(trifluoromethoxy)pyridin-2-amine |
| SMILES | NCc1c(OC(F)(F)F)cnc(N)c1Cl |
| InChI | InChI=1S/C7H7ClF3N3O/c8-5-3(1-12)4(2-14-6(5)13)15-7(9,10)11/h2H,1,12H2,(H2,13,14) |
| InChIKey | DETLWOBRDXXSFA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.60 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |