C7H8F3N3O2 — CID 119001508
6-amino-4-(aminomethyl)-5-(trifluoromethoxy)pyridin-3-ol (PubChem CID 119001508) has the molecular formula C7H8F3N3O2 and a molecular weight of 223.15 g/mol. Its IUPAC name is 6-amino-4-(aminomethyl)-5-(trifluoromethoxy)pyridin-3-ol.
| Compound Name | 6-amino-4-(aminomethyl)-5-(trifluoromethoxy)pyridin-3-ol |
|---|---|
| PubChem CID | 119001508 |
| Molecular Formula | C7H8F3N3O2 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 6-amino-4-(aminomethyl)-5-(trifluoromethoxy)pyridin-3-ol |
| SMILES | NCc1c(O)cnc(N)c1OC(F)(F)F |
| InChI | InChI=1S/C7H8F3N3O2/c8-7(9,10)15-5-3(1-11)4(14)2-13-6(5)12/h2,14H,1,11H2,(H2,12,13) |
| InChIKey | APDYYZHGDGFNHQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |