C8H7F3N4O — CID 119011895
2-amino-5-(aminomethyl)-3-(trifluoromethoxy)pyridine-4-carbonitrile (PubChem CID 119011895) has the molecular formula C8H7F3N4O and a molecular weight of 232.16 g/mol. Its IUPAC name is 2-amino-5-(aminomethyl)-3-(trifluoromethoxy)pyridine-4-carbonitrile.
| Compound Name | 2-amino-5-(aminomethyl)-3-(trifluoromethoxy)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 119011895 |
| Molecular Formula | C8H7F3N4O |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-amino-5-(aminomethyl)-3-(trifluoromethoxy)pyridine-4-carbonitrile |
| SMILES | N#Cc1c(CN)cnc(N)c1OC(F)(F)F |
| InChI | InChI=1S/C8H7F3N4O/c9-8(10,11)16-6-5(2-13)4(1-12)3-15-7(6)14/h3H,1,12H2,(H2,14,15) |
| InChIKey | DMBOFAWXGMQGKJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |