C9H9F3N4O — CID 118990941
2-[2-amino-5-(aminomethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetonitrile (PubChem CID 118990941) has the molecular formula C9H9F3N4O and a molecular weight of 246.19 g/mol. Its IUPAC name is 2-[2-amino-5-(aminomethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[2-amino-5-(aminomethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118990941 |
| Molecular Formula | C9H9F3N4O |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-[2-amino-5-(aminomethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetonitrile |
| SMILES | N#CCc1c(N)ncc(CN)c1OC(F)(F)F |
| InChI | InChI=1S/C9H9F3N4O/c10-9(11,12)17-7-5(3-14)4-16-8(15)6(7)1-2-13/h4H,1,3,14H2,(H2,15,16) |
| InChIKey | LVELUTLWTCZAHF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |