C10H10F3N3O — CID 134663767
2-[5-(aminomethyl)-4-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile (PubChem CID 134663767) has the molecular formula C10H10F3N3O and a molecular weight of 245.20 g/mol. Its IUPAC name is 2-[5-(aminomethyl)-4-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[5-(aminomethyl)-4-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134663767 |
| Molecular Formula | C10H10F3N3O |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-[5-(aminomethyl)-4-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile |
| SMILES | Cc1c(CN)cnc(OC(F)(F)F)c1CC#N |
| InChI | InChI=1S/C10H10F3N3O/c1-6-7(4-15)5-16-9(8(6)2-3-14)17-10(11,12)13/h5H,2,4,15H2,1H3 |
| InChIKey | GIIWBEHYCGOSMM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |