C9H4F6N2 — CID 118840572
2-[4-(difluoromethyl)-5-fluoro-3-(trifluoromethyl)-2-pyridinyl]acetonitrile (PubChem CID 118840572) has the molecular formula C9H4F6N2 and a molecular weight of 254.13 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-5-fluoro-3-(trifluoromethyl)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4-(difluoromethyl)-5-fluoro-3-(trifluoromethyl)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118840572 |
| Molecular Formula | C9H4F6N2 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-[4-(difluoromethyl)-5-fluoro-3-(trifluoromethyl)-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1ncc(F)c(C(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H4F6N2/c10-4-3-17-5(1-2-16)7(9(13,14)15)6(4)8(11)12/h3,8H,1H2 |
| InChIKey | JLHBEACETNNRPV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |