C8H4F4N2 — CID 130099807
2-[3-(difluoromethyl)-2,5-difluoro-4-pyridinyl]acetonitrile (PubChem CID 130099807) has the molecular formula C8H4F4N2 and a molecular weight of 204.13 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-2,5-difluoro-4-pyridinyl]acetonitrile.
| Compound Name | 2-[3-(difluoromethyl)-2,5-difluoro-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130099807 |
| Molecular Formula | C8H4F4N2 |
| Molecular Weight | 204.13 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 2-[3-(difluoromethyl)-2,5-difluoro-4-pyridinyl]acetonitrile |
| SMILES | N#CCc1c(F)cnc(F)c1C(F)F |
| InChI | InChI=1S/C8H4F4N2/c9-5-3-14-8(12)6(7(10)11)4(5)1-2-13/h3,7H,1H2 |
| InChIKey | CDCQWJLKNYJGBY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|