C8H9F2N3O2 — CID 119021570
2-amino-4-(aminomethyl)-5-(difluoromethyl)pyridine-3-carboxylic acid (PubChem CID 119021570) has the molecular formula C8H9F2N3O2 and a molecular weight of 217.18 g/mol. Its IUPAC name is 2-amino-4-(aminomethyl)-5-(difluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 2-amino-4-(aminomethyl)-5-(difluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 119021570 |
| Molecular Formula | C8H9F2N3O2 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-amino-4-(aminomethyl)-5-(difluoromethyl)pyridine-3-carboxylic acid |
| SMILES | NCc1c(C(F)F)cnc(N)c1C(=O)O |
| InChI | InChI=1S/C8H9F2N3O2/c9-6(10)4-2-13-7(12)5(8(14)15)3(4)1-11/h2,6H,1,11H2,(H2,12,13)(H,14,15) |
| InChIKey | WFAHKAXERSLTTE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |