C8H6ClF5N2O3S — CID 134682315
5-(aminomethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridine-2-sulfonyl chloride (PubChem CID 134682315) has the molecular formula C8H6ClF5N2O3S and a molecular weight of 340.66 g/mol. Its IUPAC name is 5-(aminomethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridine-2-sulfonyl chloride.
| Compound Name | 5-(aminomethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridine-2-sulfonyl chloride |
|---|---|
| PubChem CID | 134682315 |
| Molecular Formula | C8H6ClF5N2O3S |
| Molecular Weight | 340.66 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 5-(aminomethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridine-2-sulfonyl chloride |
| SMILES | NCc1cnc(S(=O)(=O)Cl)c(C(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C8H6ClF5N2O3S/c9-20(17,18)7-4(6(10)11)5(19-8(12,13)14)3(1-15)2-16-7/h2,6H,1,15H2 |
| InChIKey | YSFKUUBBGFYLBV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.66 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |