C8H5ClF6N2O3S — CID 134670035
4-(aminomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)pyridine-2-sulfonyl chloride (PubChem CID 134670035) has the molecular formula C8H5ClF6N2O3S and a molecular weight of 358.65 g/mol. Its IUPAC name is 4-(aminomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)pyridine-2-sulfonyl chloride.
| Compound Name | 4-(aminomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)pyridine-2-sulfonyl chloride |
|---|---|
| PubChem CID | 134670035 |
| Molecular Formula | C8H5ClF6N2O3S |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 4-(aminomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)pyridine-2-sulfonyl chloride |
| SMILES | NCc1c(C(F)(F)F)cnc(S(=O)(=O)Cl)c1OC(F)(F)F |
| InChI | InChI=1S/C8H5ClF6N2O3S/c9-21(18,19)6-5(20-8(13,14)15)3(1-16)4(2-17-6)7(10,11)12/h2H,1,16H2 |
| InChIKey | GBOXVJZWNRALGK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |