C12H12F5NO2 — CID 171029305
ethyl 2-[4-(difluoromethyl)-5-methyl-3-(trifluoromethyl)-2-pyridinyl]acetate (PubChem CID 171029305) has the molecular formula C12H12F5NO2 and a molecular weight of 297.22 g/mol. Its IUPAC name is ethyl 2-[4-(difluoromethyl)-5-methyl-3-(trifluoromethyl)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[4-(difluoromethyl)-5-methyl-3-(trifluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 171029305 |
| Molecular Formula | C12H12F5NO2 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | ethyl 2-[4-(difluoromethyl)-5-methyl-3-(trifluoromethyl)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1ncc(C)c(C(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C12H12F5NO2/c1-3-20-8(19)4-7-10(12(15,16)17)9(11(13)14)6(2)5-18-7/h5,11H,3-4H2,1-2H3 |
| InChIKey | TWMAJWUTJIGHNP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |