C10H9F5N2O2 — CID 134669740
methyl 2-[5-amino-3-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate (PubChem CID 134669740) has the molecular formula C10H9F5N2O2 and a molecular weight of 284.18 g/mol. Its IUPAC name is methyl 2-[5-amino-3-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate.
| Compound Name | methyl 2-[5-amino-3-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134669740 |
| Molecular Formula | C10H9F5N2O2 |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | methyl 2-[5-amino-3-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1ncc(N)c(C(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C10H9F5N2O2/c1-19-6(18)2-5-7(9(11)12)8(10(13,14)15)4(16)3-17-5/h3,9H,2,16H2,1H3 |
| InChIKey | NCWMZWCDQJSJHX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |