C9H8F3NO2 — CID 133091158
methyl 2-[3-(difluoromethyl)-4-fluoro-2-pyridinyl]acetate (PubChem CID 133091158) has the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. Its IUPAC name is methyl 2-[3-(difluoromethyl)-4-fluoro-2-pyridinyl]acetate.
| Compound Name | methyl 2-[3-(difluoromethyl)-4-fluoro-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 133091158 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | methyl 2-[3-(difluoromethyl)-4-fluoro-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1nccc(F)c1C(F)F |
| InChI | InChI=1S/C9H8F3NO2/c1-15-7(14)4-6-8(9(11)12)5(10)2-3-13-6/h2-3,9H,4H2,1H3 |
| InChIKey | COFAQQBXENWWCW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |