C9H10F2N2O2 — CID 134673231
methyl 2-[5-amino-4-(difluoromethyl)-3-pyridinyl]acetate (PubChem CID 134673231) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is methyl 2-[5-amino-4-(difluoromethyl)-3-pyridinyl]acetate.
| Compound Name | methyl 2-[5-amino-4-(difluoromethyl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134673231 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | methyl 2-[5-amino-4-(difluoromethyl)-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cncc(N)c1C(F)F |
| InChI | InChI=1S/C9H10F2N2O2/c1-15-7(14)2-5-3-13-4-6(12)8(5)9(10)11/h3-4,9H,2,12H2,1H3 |
| InChIKey | HZOHFRXADTZRHF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |