C9H9F3N2O2 — CID 133098272
methyl 2-[3-amino-5-(trifluoromethyl)-4-pyridinyl]acetate (PubChem CID 133098272) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is methyl 2-[3-amino-5-(trifluoromethyl)-4-pyridinyl]acetate.
| Compound Name | methyl 2-[3-amino-5-(trifluoromethyl)-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 133098272 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | methyl 2-[3-amino-5-(trifluoromethyl)-4-pyridinyl]acetate |
| SMILES | COC(=O)Cc1c(N)cncc1C(F)(F)F |
| InChI | InChI=1S/C9H9F3N2O2/c1-16-8(15)2-5-6(9(10,11)12)3-14-4-7(5)13/h3-4H,2,13H2,1H3 |
| InChIKey | YYRXPSIVWBJXDK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |