C13H16ClF2NO — CID 114275318
7-amino-1-(6-chloro-2,3-difluorophenyl)heptan-1-one (PubChem CID 114275318) has the molecular formula C13H16ClF2NO and a molecular weight of 275.73 g/mol. Its IUPAC name is 7-amino-1-(6-chloro-2,3-difluorophenyl)heptan-1-one.
| Compound Name | 7-amino-1-(6-chloro-2,3-difluorophenyl)heptan-1-one |
|---|---|
| PubChem CID | 114275318 |
| Molecular Formula | C13H16ClF2NO |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 7-amino-1-(6-chloro-2,3-difluorophenyl)heptan-1-one |
| SMILES | NCCCCCCC(=O)c1c(Cl)ccc(F)c1F |
| InChI | InChI=1S/C13H16ClF2NO/c14-9-6-7-10(15)13(16)12(9)11(18)5-3-1-2-4-8-17/h6-7H,1-5,8,17H2 |
| InChIKey | RWAQLXGMIDRNID-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|