C12H18N4O2 — CID 159137360
benzene-1,2-dicarboxamide;piperazine (PubChem CID 159137360) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is benzene-1,2-dicarboxamide;piperazine.
| Compound Name | benzene-1,2-dicarboxamide;piperazine |
|---|---|
| PubChem CID | 159137360 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | benzene-1,2-dicarboxamide;piperazine |
| SMILES | C1CNCCN1.NC(=O)c1ccccc1C(N)=O |
| InChI | InChI=1S/C8H8N2O2.C4H10N2/c9-7(11)5-3-1-2-4-6(5)8(10)12;1-2-6-4-3-5-1/h1-4H,(H2,9,11)(H2,10,12);5-6H,1-4H2 |
| InChIKey | KHQWPLUMQKQAMY-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |