About azetidin-2-one;benzene-1,2-dicarboxamide
azetidin-2-one;benzene-1,2-dicarboxamide (PubChem CID 158728506) has the molecular formula C11H13N3O3
and a molecular weight of 235.24 g/mol. Its IUPAC name is azetidin-2-one;benzene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | azetidin-2-one;benzene-1,2-dicarboxamide |
| PubChem CID | 158728506 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | azetidin-2-one;benzene-1,2-dicarboxamide |
| SMILES | NC(=O)c1ccccc1C(N)=O.O=C1CCN1 |
| InChI | InChI=1S/C8H8N2O2.C3H5NO/c9-7(11)5-3-1-2-4-6(5)8(10)12;5-3-1-2-4-3/h1-4H,(H2,9,11)(H2,10,12);1-2H2,(H,4,5) |
| InChIKey | IKUQSCVXWQRNHQ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azetidin-2-one;benzene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-2-one;benzene-1,2-dicarboxamide?
The IUPAC name of azetidin-2-one;benzene-1,2-dicarboxamide (CID 158728506) is azetidin-2-one;benzene-1,2-dicarboxamide.
What is the SMILES notation for azetidin-2-one;benzene-1,2-dicarboxamide?
The canonical SMILES for azetidin-2-one;benzene-1,2-dicarboxamide is NC(=O)c1ccccc1C(N)=O.O=C1CCN1.
What is the InChIKey of azetidin-2-one;benzene-1,2-dicarboxamide?
The InChIKey is IKUQSCVXWQRNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2.C3H5NO/c9-7(11)5-3-1-2-4-6(5)8(10)12;5-3-1-2-4-3/h1-4H,(H2,9,11)(H2,10,12);1-2H2,(H,4,5).
What are the key properties of azetidin-2-one;benzene-1,2-dicarboxamide?
azetidin-2-one;benzene-1,2-dicarboxamide has a molecular weight of 235.24 g/mol, XLogP of -0.61, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-2-one;benzene-1,2-dicarboxamide is sourced from PubChem (CID 158728506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).