About benzene-1,2-dicarboxamide
benzene-1,2-dicarboxamide (PubChem CID 6956) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is benzene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | benzene-1,2-dicarboxamide |
| PubChem CID | 6956 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | benzene-1,2-dicarboxamide |
| SMILES | NC(=O)c1ccccc1C(N)=O |
| InChI | InChI=1S/C8H8N2O2/c9-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H,(H2,9,11)(H2,10,12) |
| InChIKey | NAYYNDKKHOIIOD-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-dicarboxamide?
The IUPAC name of benzene-1,2-dicarboxamide (CID 6956) is benzene-1,2-dicarboxamide.
What is the SMILES notation for benzene-1,2-dicarboxamide?
The canonical SMILES for benzene-1,2-dicarboxamide is NC(=O)c1ccccc1C(N)=O.
What is the InChIKey of benzene-1,2-dicarboxamide?
The InChIKey is NAYYNDKKHOIIOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c9-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H,(H2,9,11)(H2,10,12).
What are the key properties of benzene-1,2-dicarboxamide?
benzene-1,2-dicarboxamide has a molecular weight of 164.16 g/mol, XLogP of -0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-dicarboxamide is sourced from PubChem (CID 6956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).