About 4-Fluorobenzamide
4-Fluorobenzamide (PubChem CID 71572) has the molecular formula C7H6FNO
and a molecular weight of 139.13 g/mol. Its IUPAC name is 4-fluorobenzamide.
Molecular Properties
| Compound Name | 4-Fluorobenzamide |
| PubChem CID | 71572 |
| Molecular Formula | C7H6FNO |
| Molecular Weight | 139.13 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | 4-fluorobenzamide |
| SMILES | C1=CC(=CC=C1C(=O)N)F |
| InChI | InChI=1S/C7H6FNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10) |
| InChIKey | VNDHYTGVCGVETQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 43.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 130 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.13 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-Fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Fluorobenzamide?
The IUPAC name of 4-Fluorobenzamide (CID 71572) is 4-fluorobenzamide.
What is the SMILES notation for 4-Fluorobenzamide?
The canonical SMILES for 4-Fluorobenzamide is C1=CC(=CC=C1C(=O)N)F.
What is the InChIKey of 4-Fluorobenzamide?
The InChIKey is VNDHYTGVCGVETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10).
What are the key properties of 4-Fluorobenzamide?
4-Fluorobenzamide has a molecular weight of 139.13 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Fluorobenzamide is sourced from PubChem (CID 71572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).