About benzohydrazide
benzohydrazide (PubChem CID 11955) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is benzohydrazide.
Molecular Properties
| Compound Name | benzohydrazide |
| PubChem CID | 11955 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | benzohydrazide |
| SMILES | NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8N2O/c8-9-7(10)6-4-2-1-3-5-6/h1-5H,8H2,(H,9,10) |
| InChIKey | WARCRYXKINZHGQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzohydrazide?
The IUPAC name of benzohydrazide (CID 11955) is benzohydrazide.
What is the SMILES notation for benzohydrazide?
The canonical SMILES for benzohydrazide is NNC(=O)c1ccccc1.
What is the InChIKey of benzohydrazide?
The InChIKey is WARCRYXKINZHGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c8-9-7(10)6-4-2-1-3-5-6/h1-5H,8H2,(H,9,10).
What are the key properties of benzohydrazide?
benzohydrazide has a molecular weight of 136.15 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzohydrazide is sourced from PubChem (CID 11955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).