About N-hydroxybenzamide
N-hydroxybenzamide (PubChem CID 10313) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is N-hydroxybenzamide.
Molecular Properties
| Compound Name | N-hydroxybenzamide |
| PubChem CID | 10313 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccccc1 |
| InChI | InChI=1S/C7H7NO2/c9-7(8-10)6-4-2-1-3-5-6/h1-5,10H,(H,8,9) |
| InChIKey | VDEUYMSGMPQMIK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxybenzamide?
The IUPAC name of N-hydroxybenzamide (CID 10313) is N-hydroxybenzamide.
What is the SMILES notation for N-hydroxybenzamide?
The canonical SMILES for N-hydroxybenzamide is O=C(NO)c1ccccc1.
What is the InChIKey of N-hydroxybenzamide?
The InChIKey is VDEUYMSGMPQMIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c9-7(8-10)6-4-2-1-3-5-6/h1-5,10H,(H,8,9).
What are the key properties of N-hydroxybenzamide?
N-hydroxybenzamide has a molecular weight of 137.14 g/mol, XLogP of 0.81, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxybenzamide is sourced from PubChem (CID 10313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).