About 2-hydroxypropanedioic acid;1H-pyridin-2-one
2-hydroxypropanedioic acid;1H-pyridin-2-one (PubChem CID 71407097) has the molecular formula C8H9NO6
and a molecular weight of 215.16 g/mol. Its IUPAC name is 2-hydroxypropanedioic acid;1H-pyridin-2-one.
Molecular Properties
| Compound Name | 2-hydroxypropanedioic acid;1H-pyridin-2-one |
| PubChem CID | 71407097 |
| Molecular Formula | C8H9NO6 |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 2-hydroxypropanedioic acid;1H-pyridin-2-one |
| SMILES | O=C(O)C(O)C(=O)O.O=c1cccc[nH]1 |
| InChI | InChI=1S/C5H5NO.C3H4O5/c7-5-3-1-2-4-6-5;4-1(2(5)6)3(7)8/h1-4H,(H,6,7);1,4H,(H,5,6)(H,7,8) |
| InChIKey | XEHKLUYSIDCOMK-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanedioic acid;1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanedioic acid;1H-pyridin-2-one?
The IUPAC name of 2-hydroxypropanedioic acid;1H-pyridin-2-one (CID 71407097) is 2-hydroxypropanedioic acid;1H-pyridin-2-one.
What is the SMILES notation for 2-hydroxypropanedioic acid;1H-pyridin-2-one?
The canonical SMILES for 2-hydroxypropanedioic acid;1H-pyridin-2-one is O=C(O)C(O)C(=O)O.O=c1cccc[nH]1.
What is the InChIKey of 2-hydroxypropanedioic acid;1H-pyridin-2-one?
The InChIKey is XEHKLUYSIDCOMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO.C3H4O5/c7-5-3-1-2-4-6-5;4-1(2(5)6)3(7)8/h1-4H,(H,6,7);1,4H,(H,5,6)(H,7,8).
What are the key properties of 2-hydroxypropanedioic acid;1H-pyridin-2-one?
2-hydroxypropanedioic acid;1H-pyridin-2-one has a molecular weight of 215.16 g/mol, XLogP of -1.11, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanedioic acid;1H-pyridin-2-one is sourced from PubChem (CID 71407097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).