About N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one
N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one (PubChem CID 68518788) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one.
Molecular Properties
| Compound Name | N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one |
| PubChem CID | 68518788 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one |
| SMILES | CCN(C(C)C)C(C)C.O=c1cccc[nH]1 |
| InChI | InChI=1S/C8H19N.C5H5NO/c1-6-9(7(2)3)8(4)5;7-5-3-1-2-4-6-5/h7-8H,6H2,1-5H3;1-4H,(H,6,7) |
| InChIKey | ZXBSAERQTGCEBP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one?
The IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one (CID 68518788) is N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one.
What is the SMILES notation for N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one?
The canonical SMILES for N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one is CCN(C(C)C)C(C)C.O=c1cccc[nH]1.
What is the InChIKey of N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one?
The InChIKey is ZXBSAERQTGCEBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C5H5NO/c1-6-9(7(2)3)8(4)5;7-5-3-1-2-4-6-5/h7-8H,6H2,1-5H3;1-4H,(H,6,7).
What are the key properties of N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one?
N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one has a molecular weight of 224.35 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propan-2-ylpropan-2-amine;1H-pyridin-2-one is sourced from PubChem (CID 68518788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).