About 5-hydroxy-2-iodobenzamide;2-iodobenzamide
5-hydroxy-2-iodobenzamide;2-iodobenzamide (PubChem CID 174940863) has the molecular formula C14H12I2N2O3
and a molecular weight of 510.07 g/mol. Its IUPAC name is 5-hydroxy-2-iodobenzamide;2-iodobenzamide.
Molecular Properties
| Compound Name | 5-hydroxy-2-iodobenzamide;2-iodobenzamide |
| PubChem CID | 174940863 |
| Molecular Formula | C14H12I2N2O3 |
| Molecular Weight | 510.07 g/mol |
| Exact Mass | 509.89 |
| IUPAC Name | 5-hydroxy-2-iodobenzamide;2-iodobenzamide |
| SMILES | NC(=O)c1cc(O)ccc1I.NC(=O)c1ccccc1I |
| InChI | InChI=1S/C7H6INO2.C7H6INO/c8-6-2-1-4(10)3-5(6)7(9)11;8-6-4-2-1-3-5(6)7(9)10/h1-3,10H,(H2,9,11);1-4H,(H2,9,10) |
| InChIKey | ZBGKDPVMZQQNLG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.07 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2-iodobenzamide;2-iodobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-iodobenzamide;2-iodobenzamide?
The IUPAC name of 5-hydroxy-2-iodobenzamide;2-iodobenzamide (CID 174940863) is 5-hydroxy-2-iodobenzamide;2-iodobenzamide.
What is the SMILES notation for 5-hydroxy-2-iodobenzamide;2-iodobenzamide?
The canonical SMILES for 5-hydroxy-2-iodobenzamide;2-iodobenzamide is NC(=O)c1cc(O)ccc1I.NC(=O)c1ccccc1I.
What is the InChIKey of 5-hydroxy-2-iodobenzamide;2-iodobenzamide?
The InChIKey is ZBGKDPVMZQQNLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6INO2.C7H6INO/c8-6-2-1-4(10)3-5(6)7(9)11;8-6-4-2-1-3-5(6)7(9)10/h1-3,10H,(H2,9,11);1-4H,(H2,9,10).
What are the key properties of 5-hydroxy-2-iodobenzamide;2-iodobenzamide?
5-hydroxy-2-iodobenzamide;2-iodobenzamide has a molecular weight of 510.07 g/mol, XLogP of 2.49, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-iodobenzamide;2-iodobenzamide is sourced from PubChem (CID 174940863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).