About 1-aminoethyl 3-acetyl-2-hydroxybenzoate
1-aminoethyl 3-acetyl-2-hydroxybenzoate (PubChem CID 68765153) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is 1-aminoethyl 3-acetyl-2-hydroxybenzoate.
Molecular Properties
| Compound Name | 1-aminoethyl 3-acetyl-2-hydroxybenzoate |
| PubChem CID | 68765153 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 1-aminoethyl 3-acetyl-2-hydroxybenzoate |
| SMILES | CC(=O)c1cccc(C(=O)OC(C)N)c1O |
| InChI | InChI=1S/C11H13NO4/c1-6(13)8-4-3-5-9(10(8)14)11(15)16-7(2)12/h3-5,7,14H,12H2,1-2H3 |
| InChIKey | DFSOBWGSYZEULH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethyl 3-acetyl-2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethyl 3-acetyl-2-hydroxybenzoate?
The IUPAC name of 1-aminoethyl 3-acetyl-2-hydroxybenzoate (CID 68765153) is 1-aminoethyl 3-acetyl-2-hydroxybenzoate.
What is the SMILES notation for 1-aminoethyl 3-acetyl-2-hydroxybenzoate?
The canonical SMILES for 1-aminoethyl 3-acetyl-2-hydroxybenzoate is CC(=O)c1cccc(C(=O)OC(C)N)c1O.
What is the InChIKey of 1-aminoethyl 3-acetyl-2-hydroxybenzoate?
The InChIKey is DFSOBWGSYZEULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c1-6(13)8-4-3-5-9(10(8)14)11(15)16-7(2)12/h3-5,7,14H,12H2,1-2H3.
What are the key properties of 1-aminoethyl 3-acetyl-2-hydroxybenzoate?
1-aminoethyl 3-acetyl-2-hydroxybenzoate has a molecular weight of 223.23 g/mol, XLogP of 1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethyl 3-acetyl-2-hydroxybenzoate is sourced from PubChem (CID 68765153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).