About propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate
propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate (PubChem CID 163585949) has the molecular formula C12H21N3O2S
and a molecular weight of 271.39 g/mol. Its IUPAC name is propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate.
Molecular Properties
| Compound Name | propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate |
| PubChem CID | 163585949 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate |
| SMILES | CC(C)OC(=O)c1ccccc1CCS(N)(N)N |
| InChI | InChI=1S/C12H21N3O2S/c1-9(2)17-12(16)11-6-4-3-5-10(11)7-8-18(13,14)15/h3-6,9H,7-8,13-15H2,1-2H3 |
| InChIKey | GLMBXMSKCQWOCX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate?
The IUPAC name of propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate (CID 163585949) is propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate.
What is the SMILES notation for propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate?
The canonical SMILES for propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate is CC(C)OC(=O)c1ccccc1CCS(N)(N)N.
What is the InChIKey of propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate?
The InChIKey is GLMBXMSKCQWOCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2S/c1-9(2)17-12(16)11-6-4-3-5-10(11)7-8-18(13,14)15/h3-6,9H,7-8,13-15H2,1-2H3.
What are the key properties of propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate?
propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate has a molecular weight of 271.39 g/mol, XLogP of 1.22, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[2-(triamino-λ4-sulfanyl)ethyl]benzoate is sourced from PubChem (CID 163585949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).