C16H18O5 — CID 76609559
8-(2,5-dihydroxyphenyl)-2,6-dimethyl-8-oxoocta-2,6-dienoic acid (PubChem CID 76609559) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is 8-(2,5-dihydroxyphenyl)-2,6-dimethyl-8-oxoocta-2,6-dienoic acid.
| Compound Name | 8-(2,5-dihydroxyphenyl)-2,6-dimethyl-8-oxoocta-2,6-dienoic acid |
|---|---|
| PubChem CID | 76609559 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 8-(2,5-dihydroxyphenyl)-2,6-dimethyl-8-oxoocta-2,6-dienoic acid |
| SMILES | CC(=CC(=O)c1cc(O)ccc1O)CCC=C(C)C(=O)O |
| InChI | InChI=1S/C16H18O5/c1-10(4-3-5-11(2)16(20)21)8-15(19)13-9-12(17)6-7-14(13)18/h5-9,17-18H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | RNESCYAQSWYFLZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|