C15H16O3 — CID 69493754
2-methyl-6-oxo-8-phenylocta-2,7-dienoic acid (PubChem CID 69493754) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-methyl-6-oxo-8-phenylocta-2,7-dienoic acid.
| Compound Name | 2-methyl-6-oxo-8-phenylocta-2,7-dienoic acid |
|---|---|
| PubChem CID | 69493754 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-methyl-6-oxo-8-phenylocta-2,7-dienoic acid |
| SMILES | CC(=CCCC(=O)C=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H16O3/c1-12(15(17)18)6-5-9-14(16)11-10-13-7-3-2-4-8-13/h2-4,6-8,10-11H,5,9H2,1H3,(H,17,18) |
| InChIKey | RLEHFYZIRUDEKD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|