C23H22O3 — CID 173175041
(7E)-2-methyl-6-oxo-8-phenyl-3-(2-phenylethenyl)octa-2,7-dienoic acid (PubChem CID 173175041) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is (7E)-2-methyl-6-oxo-8-phenyl-3-(2-phenylethenyl)octa-2,7-dienoic acid.
| Compound Name | (7E)-2-methyl-6-oxo-8-phenyl-3-(2-phenylethenyl)octa-2,7-dienoic acid |
|---|---|
| PubChem CID | 173175041 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (7E)-2-methyl-6-oxo-8-phenyl-3-(2-phenylethenyl)octa-2,7-dienoic acid |
| SMILES | CC(C(=O)O)=C(C=Cc1ccccc1)CCC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H22O3/c1-18(23(25)26)21(14-12-19-8-4-2-5-9-19)15-17-22(24)16-13-20-10-6-3-7-11-20/h2-14,16H,15,17H2,1H3,(H,25,26)/b14-12?,16-13+,21-18? |
| InChIKey | YLXVLZQZJZYJSI-KNSGYJMISA-N |
| XLogP | 5.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|