C22H20O4 — CID 87734000
5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid (PubChem CID 87734000) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid.
| Compound Name | 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid |
|---|---|
| PubChem CID | 87734000 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid |
| SMILES | CC(=CCC(C(=O)O)=C(C=Cc1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H20O4/c1-16(21(23)24)12-14-20(22(25)26)19(18-10-6-3-7-11-18)15-13-17-8-4-2-5-9-17/h2-13,15H,14H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | RATVSWJBLWTOAS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|