5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid

C22H20O4 — CID 87734000

IUPAC5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid
SMILESCC(=CCC(C(=O)O)=C(C=Cc1ccccc1)c1ccccc1)C(=O)O
InChIInChI=1S/C22H20O4/c1-16(21(23)24)12-14-20(22(25)26)19(18-10-6-3-7-11-18)15-13-17-8-4-2-5-9-17/h2-13,15H,14H2,1H3,(H,23,24)(H,25,26)
InChIKeyRATVSWJBLWTOAS-UHFFFAOYSA-N
MW348.40 g/mol
LogP4.66
Rot. Bonds7

About 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid

5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid (PubChem CID 87734000) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid.

Molecular Properties

Compound Name5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid
PubChem CID87734000
Molecular FormulaC22H20O4
Molecular Weight348.40 g/mol
Exact Mass348.14
IUPAC Name5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid
SMILESCC(=CCC(C(=O)O)=C(C=Cc1ccccc1)c1ccccc1)C(=O)O
InChIInChI=1S/C22H20O4/c1-16(21(23)24)12-14-20(22(25)26)19(18-10-6-3-7-11-18)15-13-17-8-4-2-5-9-17/h2-13,15H,14H2,1H3,(H,23,24)(H,25,26)
InChIKeyRATVSWJBLWTOAS-UHFFFAOYSA-N
XLogP4.66
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.40
LogP ≤ 54.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid?
The IUPAC name of 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid (CID 87734000) is 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid.
What is the SMILES notation for 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid?
The canonical SMILES for 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid is CC(=CCC(C(=O)O)=C(C=Cc1ccccc1)c1ccccc1)C(=O)O.
What is the InChIKey of 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid?
The InChIKey is RATVSWJBLWTOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O4/c1-16(21(23)24)12-14-20(22(25)26)19(18-10-6-3-7-11-18)15-13-17-8-4-2-5-9-17/h2-13,15H,14H2,1H3,(H,23,24)(H,25,26).
What are the key properties of 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid?
5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid has a molecular weight of 348.40 g/mol, XLogP of 4.66, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-diphenylprop-2-enylidene)-2-methylhex-2-enedioic acid is sourced from PubChem (CID 87734000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).