C16H19BrO3 — CID 162941077
1-(3-bromo-2,5-dihydroxyphenyl)-3,7-dimethylocta-2,6-dien-1-one (PubChem CID 162941077) has the molecular formula C16H19BrO3 and a molecular weight of 339.23 g/mol. Its IUPAC name is 1-(3-bromo-2,5-dihydroxyphenyl)-3,7-dimethylocta-2,6-dien-1-one.
| Compound Name | 1-(3-bromo-2,5-dihydroxyphenyl)-3,7-dimethylocta-2,6-dien-1-one |
|---|---|
| PubChem CID | 162941077 |
| Molecular Formula | C16H19BrO3 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1-(3-bromo-2,5-dihydroxyphenyl)-3,7-dimethylocta-2,6-dien-1-one |
| SMILES | CC(C)=CCCC(C)=CC(=O)c1cc(O)cc(Br)c1O |
| InChI | InChI=1S/C16H19BrO3/c1-10(2)5-4-6-11(3)7-15(19)13-8-12(18)9-14(17)16(13)20/h5,7-9,18,20H,4,6H2,1-3H3 |
| InChIKey | ZBBFBLKJCIWCPI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|