C18H24O2 — CID 170275320
(4-methylphenyl)methyl (2E)-3,7-dimethylocta-2,6-dienoate (PubChem CID 170275320) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (4-methylphenyl)methyl (2E)-3,7-dimethylocta-2,6-dienoate.
| Compound Name | (4-methylphenyl)methyl (2E)-3,7-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 170275320 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (4-methylphenyl)methyl (2E)-3,7-dimethylocta-2,6-dienoate |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)OCc1ccc(C)cc1 |
| InChI | InChI=1S/C18H24O2/c1-14(2)6-5-7-16(4)12-18(19)20-13-17-10-8-15(3)9-11-17/h6,8-12H,5,7,13H2,1-4H3/b16-12+ |
| InChIKey | LFBANEIAANQFOG-FOWTUZBSSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|