C22H28N2O6 — CID 136862719
2-[N-[2-[2-[2-[1-(2,5-dihydroxyphenyl)ethylideneamino]ethoxy]ethoxy]ethyl]-C-methylcarbonimidoyl]benzene-1,4-diol (PubChem CID 136862719) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 2-[N-[2-[2-[2-[1-(2,5-dihydroxyphenyl)ethylideneamino]ethoxy]ethoxy]ethyl]-C-methylcarbonimidoyl]benzene-1,4-diol.
| Compound Name | 2-[N-[2-[2-[2-[1-(2,5-dihydroxyphenyl)ethylideneamino]ethoxy]ethoxy]ethyl]-C-methylcarbonimidoyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 136862719 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-[N-[2-[2-[2-[1-(2,5-dihydroxyphenyl)ethylideneamino]ethoxy]ethoxy]ethyl]-C-methylcarbonimidoyl]benzene-1,4-diol |
| SMILES | C/C(=N\CCOCCOCC/N=C(\C)c1cc(O)ccc1O)c1cc(O)ccc1O |
| InChI | InChI=1S/C22H28N2O6/c1-15(19-13-17(25)3-5-21(19)27)23-7-9-29-11-12-30-10-8-24-16(2)20-14-18(26)4-6-22(20)28/h3-6,13-14,25-28H,7-12H2,1-2H3/b23-15+,24-16+ |
| InChIKey | MSBBZFXULZWDHD-DFEHQXHXSA-N |
| XLogP | 2.86 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|