C11H16N2O — CID 137181033
2-[N-(2-aminoethyl)-C-methylcarbonimidoyl]-4-methylphenol (PubChem CID 137181033) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-[N-(2-aminoethyl)-C-methylcarbonimidoyl]-4-methylphenol.
| Compound Name | 2-[N-(2-aminoethyl)-C-methylcarbonimidoyl]-4-methylphenol |
|---|---|
| PubChem CID | 137181033 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-[N-(2-aminoethyl)-C-methylcarbonimidoyl]-4-methylphenol |
| SMILES | C/C(=N\CCN)c1cc(C)ccc1O |
| InChI | InChI=1S/C11H16N2O/c1-8-3-4-11(14)10(7-8)9(2)13-6-5-12/h3-4,7,14H,5-6,12H2,1-2H3/b13-9+ |
| InChIKey | ZQYFDMNBXKTGAV-UKTHLTGXSA-N |
| XLogP | 1.47 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|