C26H40N4O2+2 — CID 136671804
[4-hydroxy-3-[N-[2-[1-[2-hydroxy-5-[(trimethylazaniumyl)methyl]phenyl]ethylideneamino]ethyl]-C-methylcarbonimidoyl]phenyl]methyl-trimethylazanium (PubChem CID 136671804) has the molecular formula C26H40N4O2+2 and a molecular weight of 440.63 g/mol. Its IUPAC name is [4-hydroxy-3-[N-[2-[1-[2-hydroxy-5-[(trimethylazaniumyl)methyl]phenyl]ethylideneamino]ethyl]-C-methylcarbonimidoyl]phenyl]methyl-trimethylazanium.
| Compound Name | [4-hydroxy-3-[N-[2-[1-[2-hydroxy-5-[(trimethylazaniumyl)methyl]phenyl]ethylideneamino]ethyl]-C-methylcarbonimidoyl]phenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 136671804 |
| Molecular Formula | C26H40N4O2+2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | [4-hydroxy-3-[N-[2-[1-[2-hydroxy-5-[(trimethylazaniumyl)methyl]phenyl]ethylideneamino]ethyl]-C-methylcarbonimidoyl]phenyl]methyl-trimethylazanium |
| SMILES | C/C(=N\CC/N=C(\C)c1cc(C[N+](C)(C)C)ccc1O)c1cc(C[N+](C)(C)C)ccc1O |
| InChI | InChI=1S/C26H38N4O2/c1-19(23-15-21(9-11-25(23)31)17-29(3,4)5)27-13-14-28-20(2)24-16-22(10-12-26(24)32)18-30(6,7)8/h9-12,15-16H,13-14,17-18H2,1-8H3/p+2 |
| InChIKey | IRNALHXLPOCVMS-UHFFFAOYSA-P |
| XLogP | 3.83 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|