C26H47N2O2+ — CID 135475375
[4-hydroxy-3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]methyl-methyl-dioctylazanium (PubChem CID 135475375) has the molecular formula C26H47N2O2+ and a molecular weight of 419.67 g/mol. Its IUPAC name is [4-hydroxy-3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]methyl-methyl-dioctylazanium.
| Compound Name | [4-hydroxy-3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]methyl-methyl-dioctylazanium |
|---|---|
| PubChem CID | 135475375 |
| Molecular Formula | C26H47N2O2+ |
| Molecular Weight | 419.67 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | [4-hydroxy-3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]methyl-methyl-dioctylazanium |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)Cc1ccc(O)c(/C(C)=N/O)c1 |
| InChI | InChI=1S/C26H46N2O2/c1-5-7-9-11-13-15-19-28(4,20-16-14-12-10-8-6-2)22-24-17-18-26(29)25(21-24)23(3)27-30/h17-18,21H,5-16,19-20,22H2,1-4H3,(H-,27,29,30)/p+1 |
| InChIKey | FAKZIOXMCZWVAP-UHFFFAOYSA-O |
| XLogP | 7.26 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.67 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|